About 1,1-diethoxy-N,3-dimethylbutan-2-amine
1,1-diethoxy-N,3-dimethylbutan-2-amine (PubChem CID 12506255) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,1-diethoxy-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1,1-diethoxy-N,3-dimethylbutan-2-amine |
| PubChem CID | 12506255 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1,1-diethoxy-N,3-dimethylbutan-2-amine |
| SMILES | CCOC(OCC)C(NC)C(C)C |
| InChI | InChI=1S/C10H23NO2/c1-6-12-10(13-7-2)9(11-5)8(3)4/h8-11H,6-7H2,1-5H3 |
| InChIKey | PQQYRAVGHKOBFI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxy-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxy-N,3-dimethylbutan-2-amine?
The IUPAC name of 1,1-diethoxy-N,3-dimethylbutan-2-amine (CID 12506255) is 1,1-diethoxy-N,3-dimethylbutan-2-amine.
What is the SMILES notation for 1,1-diethoxy-N,3-dimethylbutan-2-amine?
The canonical SMILES for 1,1-diethoxy-N,3-dimethylbutan-2-amine is CCOC(OCC)C(NC)C(C)C.
What is the InChIKey of 1,1-diethoxy-N,3-dimethylbutan-2-amine?
The InChIKey is PQQYRAVGHKOBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2/c1-6-12-10(13-7-2)9(11-5)8(3)4/h8-11H,6-7H2,1-5H3.
What are the key properties of 1,1-diethoxy-N,3-dimethylbutan-2-amine?
1,1-diethoxy-N,3-dimethylbutan-2-amine has a molecular weight of 189.30 g/mol, XLogP of 1.63, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxy-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 12506255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).