About 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one
2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one (PubChem CID 12506577) has the molecular formula C15H20Cl2O2Si
and a molecular weight of 331.32 g/mol. Its IUPAC name is 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one.
Molecular Properties
| Compound Name | 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one |
| PubChem CID | 12506577 |
| Molecular Formula | C15H20Cl2O2Si |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one |
| SMILES | CC1(C)C(=O)C(Cl)(Cl)C1(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H20Cl2O2Si/c1-13(2)12(18)15(16,17)14(13,19-20(3,4)5)11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | SFKDJRXAQXPTLL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one?
The IUPAC name of 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one (CID 12506577) is 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one.
What is the SMILES notation for 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one?
The canonical SMILES for 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one is CC1(C)C(=O)C(Cl)(Cl)C1(O[Si](C)(C)C)c1ccccc1.
What is the InChIKey of 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one?
The InChIKey is SFKDJRXAQXPTLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2O2Si/c1-13(2)12(18)15(16,17)14(13,19-20(3,4)5)11-9-7-6-8-10-11/h6-10H,1-5H3.
What are the key properties of 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one?
2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one has a molecular weight of 331.32 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-4,4-dimethyl-3-phenyl-3-trimethylsilyloxycyclobutan-1-one is sourced from PubChem (CID 12506577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).