About 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole
3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole (PubChem CID 12506987) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole |
| PubChem CID | 12506987 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole |
| SMILES | O=S(=O)(Cc1noc2ccccc12)N1CCCCC1 |
| InChI | InChI=1S/C13H16N2O3S/c16-19(17,15-8-4-1-5-9-15)10-12-11-6-2-3-7-13(11)18-14-12/h2-3,6-7H,1,4-5,8-10H2 |
| InChIKey | OCRHAXVANUNEAI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole?
The IUPAC name of 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole (CID 12506987) is 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole.
What is the SMILES notation for 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole?
The canonical SMILES for 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole is O=S(=O)(Cc1noc2ccccc12)N1CCCCC1.
What is the InChIKey of 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole?
The InChIKey is OCRHAXVANUNEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S/c16-19(17,15-8-4-1-5-9-15)10-12-11-6-2-3-7-13(11)18-14-12/h2-3,6-7H,1,4-5,8-10H2.
What are the key properties of 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole?
3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole has a molecular weight of 280.35 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(piperidin-1-ylsulfonylmethyl)-1,2-benzoxazole is sourced from PubChem (CID 12506987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).