C20H18O2 — CID 12507122
ethyl (E)-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)prop-2-enoate (PubChem CID 12507122) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (E)-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)prop-2-enoate |
|---|---|
| PubChem CID | 12507122 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl (E)-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C12CC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C20H18O2/c1-2-22-19(21)11-12-20-13-16(14-7-3-5-9-17(14)20)15-8-4-6-10-18(15)20/h3-12,16H,2,13H2,1H3/b12-11+ |
| InChIKey | BCULGZCQZVBKGB-VAWYXSNFSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|