C18H19F3N2O5S — CID 125072382
(2R)-2-(3-methoxy-N-methylsulfonylanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 125072382) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is (2R)-2-(3-methoxy-N-methylsulfonylanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2R)-2-(3-methoxy-N-methylsulfonylanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 125072382 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (2R)-2-(3-methoxy-N-methylsulfonylanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | COc1cccc(N([C@H](C)C(=O)Nc2ccc(OC(F)(F)F)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H19F3N2O5S/c1-12(23(29(3,25)26)14-5-4-6-16(11-14)27-2)17(24)22-13-7-9-15(10-8-13)28-18(19,20)21/h4-12H,1-3H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | AAQDNWFZPQBRNK-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |