C21H33N3O3S — CID 125074145
(3S)-1-ethylsulfonyl-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 125074145) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is (3S)-1-ethylsulfonyl-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethylsulfonyl-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125074145 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (3S)-1-ethylsulfonyl-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@H](C(=O)NCc2cccc(CN3CCCCC3)c2)C1 |
| InChI | InChI=1S/C21H33N3O3S/c1-2-28(26,27)24-13-7-10-20(17-24)21(25)22-15-18-8-6-9-19(14-18)16-23-11-4-3-5-12-23/h6,8-9,14,20H,2-5,7,10-13,15-17H2,1H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | PZAZWAQCWNVHFN-FQEVSTJZSA-N |
| XLogP | 2.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |