About N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide
N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide (PubChem CID 12507555) has the molecular formula C5H8N8O8
and a molecular weight of 308.17 g/mol. Its IUPAC name is N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide.
Molecular Properties
| Compound Name | N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide |
| PubChem CID | 12507555 |
| Molecular Formula | C5H8N8O8 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide |
| SMILES | [N-]=[N+]=NCCCN(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N8O8/c6-8-7-2-1-3-9(13(20)21)4-5(10(14)15,11(16)17)12(18)19/h1-4H2 |
| InChIKey | AXSSNPWORSCBPS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 224.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide?
The IUPAC name of N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide (CID 12507555) is N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide.
What is the SMILES notation for N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide?
The canonical SMILES for N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide is [N-]=[N+]=NCCCN(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide?
The InChIKey is AXSSNPWORSCBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N8O8/c6-8-7-2-1-3-9(13(20)21)4-5(10(14)15,11(16)17)12(18)19/h1-4H2.
What are the key properties of N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide?
N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide has a molecular weight of 308.17 g/mol, XLogP of -0.34, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-azidopropyl)-N-(2,2,2-trinitroethyl)nitramide is sourced from PubChem (CID 12507555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).