C15H10F11N — CID 12507582
4-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-3,4-dihydroisoquinoline (PubChem CID 12507582) has the molecular formula C15H10F11N and a molecular weight of 413.23 g/mol. Its IUPAC name is 4-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-3,4-dihydroisoquinoline.
| Compound Name | 4-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 12507582 |
| Molecular Formula | C15H10F11N |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-3,4-dihydroisoquinoline |
| SMILES | CC1CN=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C15H10F11N/c1-7-6-27-10(9-5-3-2-4-8(7)9)11(16,17)12(18,19)13(20,21)14(22,23)15(24,25)26/h2-5,7H,6H2,1H3 |
| InChIKey | ARLURJXELOYTGR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|