C12H6F7N — CID 12507585
1-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinoline (PubChem CID 12507585) has the molecular formula C12H6F7N and a molecular weight of 297.17 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinoline.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinoline |
|---|---|
| PubChem CID | 12507585 |
| Molecular Formula | C12H6F7N |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1nccc2ccccc12 |
| InChI | InChI=1S/C12H6F7N/c13-10(14,11(15,16)12(17,18)19)9-8-4-2-1-3-7(8)5-6-20-9/h1-6H |
| InChIKey | CRZJFNOYZUCWPJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|