C13H8F7N — CID 12507589
1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylisoquinoline (PubChem CID 12507589) has the molecular formula C13H8F7N and a molecular weight of 311.20 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylisoquinoline.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylisoquinoline |
|---|---|
| PubChem CID | 12507589 |
| Molecular Formula | C13H8F7N |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylisoquinoline |
| SMILES | Cc1cnc(C(F)(F)C(F)(F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C13H8F7N/c1-7-6-21-10(9-5-3-2-4-8(7)9)11(14,15)12(16,17)13(18,19)20/h2-6H,1H3 |
| InChIKey | AVOIPCNIYXAITQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|