C16H25ClN2O3S — CID 125076235
(2R)-2-(4-chloro-N-methylsulfonylanilino)-N-[(2R)-3-methylbutan-2-yl]butanamide (PubChem CID 125076235) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is (2R)-2-(4-chloro-N-methylsulfonylanilino)-N-[(2R)-3-methylbutan-2-yl]butanamide.
| Compound Name | (2R)-2-(4-chloro-N-methylsulfonylanilino)-N-[(2R)-3-methylbutan-2-yl]butanamide |
|---|---|
| PubChem CID | 125076235 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R)-2-(4-chloro-N-methylsulfonylanilino)-N-[(2R)-3-methylbutan-2-yl]butanamide |
| SMILES | CC[C@H](C(=O)N[C@H](C)C(C)C)N(c1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H25ClN2O3S/c1-6-15(16(20)18-12(4)11(2)3)19(23(5,21)22)14-9-7-13(17)8-10-14/h7-12,15H,6H2,1-5H3,(H,18,20)/t12-,15-/m1/s1 |
| InChIKey | TZDBXSWMFBFFFD-IUODEOHRSA-N |
| XLogP | 3.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |