C12H14N2O3S — CID 12507672
(2E)-2-(dimethylaminomethylidene)-4-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one (PubChem CID 12507672) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is (2E)-2-(dimethylaminomethylidene)-4-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one.
| Compound Name | (2E)-2-(dimethylaminomethylidene)-4-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 12507672 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (2E)-2-(dimethylaminomethylidene)-4-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one |
| SMILES | CN(C)/C=C1\C(=O)N(C)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H14N2O3S/c1-13(2)8-11-12(15)14(3)9-6-4-5-7-10(9)18(11,16)17/h4-8H,1-3H3/b11-8+ |
| InChIKey | BIMIKDDLMFIVBJ-DHZHZOJOSA-N |
| XLogP | 0.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|