C35H44ClN3O5S — CID 125078597
4-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide (PubChem CID 125078597) has the molecular formula C35H44ClN3O5S and a molecular weight of 654.27 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide.
| Compound Name | 4-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 125078597 |
| Molecular Formula | C35H44ClN3O5S |
| Molecular Weight | 654.27 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | 4-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]butanamide |
| SMILES | COc1ccc(N(CCCC(=O)N(Cc2cccc(C)c2)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C35H44ClN3O5S/c1-26-12-10-15-28(22-26)25-38(32(23-27-13-6-4-7-14-27)35(41)37-29-16-8-5-9-17-29)34(40)18-11-21-39(45(3,42)43)30-19-20-33(44-2)31(36)24-30/h4,6-7,10,12-15,19-20,22,24,29,32H,5,8-9,11,16-18,21,23,25H2,1-3H3,(H,37,41)/t32-/m1/s1 |
| InChIKey | LKTAFUYYDHOODS-JGCGQSQUSA-N |
| XLogP | 6.29 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.27 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |