C37H40IN3O4S — CID 125082980
(2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 125082980) has the molecular formula C37H40IN3O4S and a molecular weight of 749.72 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 125082980 |
| Molecular Formula | C37H40IN3O4S |
| Molecular Weight | 749.72 g/mol |
| Exact Mass | 749.18 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | Cc1ccc(CN(C(=O)CN(c2ccc(I)cc2)S(=O)(=O)c2ccccc2)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C37H40IN3O4S/c1-28-17-19-30(20-18-28)26-40(35(25-29-11-5-2-6-12-29)37(43)39-32-13-7-3-8-14-32)36(42)27-41(33-23-21-31(38)22-24-33)46(44,45)34-15-9-4-10-16-34/h2,4-6,9-12,15-24,32,35H,3,7-8,13-14,25-27H2,1H3,(H,39,43)/t35-/m1/s1 |
| InChIKey | PEEKSTFPDOUVNV-PGUFJCEWSA-N |
| XLogP | 6.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|