C13H10N4O6 — CID 12508586
5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 12508586) has the molecular formula C13H10N4O6 and a molecular weight of 318.25 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12508586 |
| Molecular Formula | C13H10N4O6 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C/C=C/C=C/c2c(O)[nH]c(=O)[nH]c2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N4O6/c18-8-6(9(19)15-12(22)14-8)4-2-1-3-5-7-10(20)16-13(23)17-11(7)21/h1-5H,(H2,14,15,18,19,22)(H3,16,17,20,21,23)/b2-1+,5-3+ |
| InChIKey | GPVPXAAQQDSIPD-NRNIAZNESA-N |
| XLogP | -1.37 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|