C26H24F3N3O4 — CID 1250867
(4S)-2-amino-5-oxo-1-[2-(trifluoromethyl)phenyl]-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 1250867) has the molecular formula C26H24F3N3O4 and a molecular weight of 499.49 g/mol. Its IUPAC name is (4S)-2-amino-5-oxo-1-[2-(trifluoromethyl)phenyl]-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-5-oxo-1-[2-(trifluoromethyl)phenyl]-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 1250867 |
| Molecular Formula | C26H24F3N3O4 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (4S)-2-amino-5-oxo-1-[2-(trifluoromethyl)phenyl]-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1cc([C@H]2C(C#N)=C(N)N(c3ccccc3C(F)(F)F)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C26H24F3N3O4/c1-34-20-11-14(12-21(35-2)24(20)36-3)22-15(13-30)25(31)32(18-9-6-10-19(33)23(18)22)17-8-5-4-7-16(17)26(27,28)29/h4-5,7-8,11-12,22H,6,9-10,31H2,1-3H3/t22-/m0/s1 |
| InChIKey | ZAPKEVJVMDHBKV-QFIPXVFZSA-N |
| XLogP | 5.04 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |