C24H48N4O — CID 1250923
3-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanamide (PubChem CID 1250923) has the molecular formula C24H48N4O and a molecular weight of 408.68 g/mol. Its IUPAC name is 3-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanamide.
| Compound Name | 3-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 1250923 |
| Molecular Formula | C24H48N4O |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 3-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanamide |
| SMILES | CN(CCC(=O)NC1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C24H48N4O/c1-21(2)14-18(15-22(3,4)27(21)10)25-20(29)12-13-26(9)19-16-23(5,6)28(11)24(7,8)17-19/h18-19H,12-17H2,1-11H3,(H,25,29) |
| InChIKey | PWHYGCHWVGSSMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |