About 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran
6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran (PubChem CID 12509779) has the molecular formula C8H10S2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran.
Molecular Properties
| Compound Name | 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran |
| PubChem CID | 12509779 |
| Molecular Formula | C8H10S2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran |
| SMILES | CC1CCc2ccsc2S1 |
| InChI | InChI=1S/C8H10S2/c1-6-2-3-7-4-5-9-8(7)10-6/h4-6H,2-3H2,1H3 |
| InChIKey | FWMSBNMTUTZDHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran?
The IUPAC name of 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran (CID 12509779) is 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran.
What is the SMILES notation for 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran?
The canonical SMILES for 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran is CC1CCc2ccsc2S1.
What is the InChIKey of 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran?
The InChIKey is FWMSBNMTUTZDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S2/c1-6-2-3-7-4-5-9-8(7)10-6/h4-6H,2-3H2,1H3.
What are the key properties of 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran?
6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran has a molecular weight of 170.30 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran is sourced from PubChem (CID 12509779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).