About 1-chloro-4-iodobenzene
1-chloro-4-iodobenzene (PubChem CID 12510) has the molecular formula C6H4ClI
and a molecular weight of 238.46 g/mol. Its IUPAC name is 1-chloro-4-iodobenzene.
Molecular Properties
| Compound Name | 1-chloro-4-iodobenzene |
| PubChem CID | 12510 |
| Molecular Formula | C6H4ClI |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | 1-chloro-4-iodobenzene |
| SMILES | Clc1ccc(I)cc1 |
| InChI | InChI=1S/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | GWQSENYKCGJTRI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-iodobenzene?
The IUPAC name of 1-chloro-4-iodobenzene (CID 12510) is 1-chloro-4-iodobenzene.
What is the SMILES notation for 1-chloro-4-iodobenzene?
The canonical SMILES for 1-chloro-4-iodobenzene is Clc1ccc(I)cc1.
What is the InChIKey of 1-chloro-4-iodobenzene?
The InChIKey is GWQSENYKCGJTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H.
What are the key properties of 1-chloro-4-iodobenzene?
1-chloro-4-iodobenzene has a molecular weight of 238.46 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-iodobenzene is sourced from PubChem (CID 12510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).