C9H11NO — CID 12510545
7-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 12510545) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 7-methyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 12510545 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 7-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C9H11NO/c1-7-2-3-8-9(6-7)11-5-4-10-8/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | HHFJHCXBGHXHLU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |