C29H31Cl3FN3O4S — CID 125107971
(2S)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 125107971) has the molecular formula C29H31Cl3FN3O4S and a molecular weight of 643.01 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125107971 |
| Molecular Formula | C29H31Cl3FN3O4S |
| Molecular Weight | 643.01 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C29H31Cl3FN3O4S/c1-4-19(2)34-29(38)27(14-20-8-6-5-7-9-20)35(17-21-10-12-22(33)13-11-21)28(37)18-36(41(3,39)40)26-16-24(31)23(30)15-25(26)32/h5-13,15-16,19,27H,4,14,17-18H2,1-3H3,(H,34,38)/t19-,27+/m1/s1 |
| InChIKey | OBMHWJZWPOKYQT-WINIVTDRSA-N |
| XLogP | 6.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|