About (3Z)-6-methylhepta-3,5-dien-2-one
(3Z)-6-methylhepta-3,5-dien-2-one (PubChem CID 12510894) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (3Z)-6-methylhepta-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3Z)-6-methylhepta-3,5-dien-2-one |
| PubChem CID | 12510894 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (3Z)-6-methylhepta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C\C=C(C)C |
| InChI | InChI=1S/C8H12O/c1-7(2)5-4-6-8(3)9/h4-6H,1-3H3/b6-4- |
| InChIKey | KSKXSFZGARKWOW-XQRVVYSFSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-methylhepta-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-methylhepta-3,5-dien-2-one?
The IUPAC name of (3Z)-6-methylhepta-3,5-dien-2-one (CID 12510894) is (3Z)-6-methylhepta-3,5-dien-2-one.
What is the SMILES notation for (3Z)-6-methylhepta-3,5-dien-2-one?
The canonical SMILES for (3Z)-6-methylhepta-3,5-dien-2-one is CC(=O)/C=C\C=C(C)C.
What is the InChIKey of (3Z)-6-methylhepta-3,5-dien-2-one?
The InChIKey is KSKXSFZGARKWOW-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H12O/c1-7(2)5-4-6-8(3)9/h4-6H,1-3H3/b6-4-.
What are the key properties of (3Z)-6-methylhepta-3,5-dien-2-one?
(3Z)-6-methylhepta-3,5-dien-2-one has a molecular weight of 124.18 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-methylhepta-3,5-dien-2-one is sourced from PubChem (CID 12510894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).