About (1Z)-1,2-dimethylcyclododecene
(1Z)-1,2-dimethylcyclododecene (PubChem CID 12511103) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is (1Z)-1,2-dimethylcyclododecene.
Molecular Properties
| Compound Name | (1Z)-1,2-dimethylcyclododecene |
| PubChem CID | 12511103 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (1Z)-1,2-dimethylcyclododecene |
| SMILES | C/C1=C(\C)CCCCCCCCCC1 |
| InChI | InChI=1S/C14H26/c1-13-11-9-7-5-3-4-6-8-10-12-14(13)2/h3-12H2,1-2H3/b14-13- |
| InChIKey | QPSDTRXINZMXBG-YPKPFQOOSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2-dimethylcyclododecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2-dimethylcyclododecene?
The IUPAC name of (1Z)-1,2-dimethylcyclododecene (CID 12511103) is (1Z)-1,2-dimethylcyclododecene.
What is the SMILES notation for (1Z)-1,2-dimethylcyclododecene?
The canonical SMILES for (1Z)-1,2-dimethylcyclododecene is C/C1=C(\C)CCCCCCCCCC1.
What is the InChIKey of (1Z)-1,2-dimethylcyclododecene?
The InChIKey is QPSDTRXINZMXBG-YPKPFQOOSA-N. The full InChI is InChI=1S/C14H26/c1-13-11-9-7-5-3-4-6-8-10-12-14(13)2/h3-12H2,1-2H3/b14-13-.
What are the key properties of (1Z)-1,2-dimethylcyclododecene?
(1Z)-1,2-dimethylcyclododecene has a molecular weight of 194.36 g/mol, XLogP of 5.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2-dimethylcyclododecene is sourced from PubChem (CID 12511103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).