C34H35FN4O6S — CID 125111831
(2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-[(2R)-butan-2-yl]-3-phenylpropanamide (PubChem CID 125111831) has the molecular formula C34H35FN4O6S and a molecular weight of 646.74 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-[(2R)-butan-2-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-[(2R)-butan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125111831 |
| Molecular Formula | C34H35FN4O6S |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-[(2R)-butan-2-yl]-3-phenylpropanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35FN4O6S/c1-3-25(2)36-34(41)32(21-26-11-6-4-7-12-26)37(23-27-17-19-28(35)20-18-27)33(40)24-38(29-13-10-14-30(22-29)39(42)43)46(44,45)31-15-8-5-9-16-31/h4-20,22,25,32H,3,21,23-24H2,1-2H3,(H,36,41)/t25-,32+/m1/s1 |
| InChIKey | XOBWNDXXSNWXKQ-GOXGLGGOSA-N |
| XLogP | 5.48 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|