C32H38O4 — CID 125113875
(2R)-2-[(1R,2R,5R)-2-[(E)-3-ethoxy-3-phenylprop-2-enyl]-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 125113875) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,5R)-2-[(E)-3-ethoxy-3-phenylprop-2-enyl]-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2R)-2-[(1R,2R,5R)-2-[(E)-3-ethoxy-3-phenylprop-2-enyl]-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 125113875 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (2R)-2-[(1R,2R,5R)-2-[(E)-3-ethoxy-3-phenylprop-2-enyl]-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@](C)(C/C=C(/OCC)c2ccccc2)[C@@H]([C@H]2CCc3cc(OC)ccc3C2=O)C1 |
| InChI | InChI=1S/C32H38O4/c1-6-36-29(22-10-8-7-9-11-22)16-17-32(4)28(19-24(21(2)3)20-30(32)33)27-14-12-23-18-25(35-5)13-15-26(23)31(27)34/h7-11,13,15-16,18,24,27-28H,2,6,12,14,17,19-20H2,1,3-5H3/b29-16+/t24-,27-,28-,32-/m1/s1 |
| InChIKey | PGQLBXKFCDRNTP-VMEZBLCFSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|