C22H42O3Si — CID 125113896
(3R,4R,4aR,8aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxy-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydronaphthalen-1-one (PubChem CID 125113896) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (3R,4R,4aR,8aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxy-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydronaphthalen-1-one.
| Compound Name | (3R,4R,4aR,8aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxy-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 125113896 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (3R,4R,4aR,8aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxy-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydronaphthalen-1-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@](C)(O)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C22H42O3Si/c1-19(2,3)26(8,9)25-14-11-17-21(6)13-10-12-20(4,5)18(21)16(23)15-22(17,7)24/h17-18,24H,10-15H2,1-9H3/t17-,18+,21-,22-/m1/s1 |
| InChIKey | QIURQIHESFSKQO-GMQQQROESA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|