C15H21NO2 — CID 125113976
(1S,3S,4aS,8aS)-4a-hydroxy-8a-methyl-6-oxo-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalene-1-carbonitrile (PubChem CID 125113976) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (1S,3S,4aS,8aS)-4a-hydroxy-8a-methyl-6-oxo-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalene-1-carbonitrile.
| Compound Name | (1S,3S,4aS,8aS)-4a-hydroxy-8a-methyl-6-oxo-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 125113976 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (1S,3S,4aS,8aS)-4a-hydroxy-8a-methyl-6-oxo-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalene-1-carbonitrile |
| SMILES | C=C(C)[C@H]1C[C@H](C#N)[C@]2(C)CCC(=O)C[C@@]2(O)C1 |
| InChI | InChI=1S/C15H21NO2/c1-10(2)11-6-12(9-16)14(3)5-4-13(17)8-15(14,18)7-11/h11-12,18H,1,4-8H2,2-3H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | VHGWSMCAHSJSNJ-NEBZKDRISA-N |
| XLogP | 2.60 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|