C28H36N2O8S2 — CID 125114096
(E)-3-[2,4-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5-methoxyphenyl]-1-phenylprop-2-en-1-one (PubChem CID 125114096) has the molecular formula C28H36N2O8S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is (E)-3-[2,4-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5-methoxyphenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[2,4-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5-methoxyphenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 125114096 |
| Molecular Formula | C28H36N2O8S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (E)-3-[2,4-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5-methoxyphenyl]-1-phenylprop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccccc2)c(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1S(=O)(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C28H36N2O8S2/c1-19-15-29(16-20(2)37-19)39(32,33)27-14-28(40(34,35)30-17-21(3)38-22(4)18-30)26(36-5)13-24(27)11-12-25(31)23-9-7-6-8-10-23/h6-14,19-22H,15-18H2,1-5H3/b12-11+/t19-,20+,21-,22+ |
| InChIKey | IKAMAACLFKICQT-XXFNKLNESA-N |
| XLogP | 3.19 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|