C11H13N3O7 — CID 125114914
(2R,3S)-2-(3,5-dinitro-4-oxo-1-pyridinyl)-3-methylpentanoic acid (PubChem CID 125114914) has the molecular formula C11H13N3O7 and a molecular weight of 299.24 g/mol. Its IUPAC name is (2R,3S)-2-(3,5-dinitro-4-oxo-1-pyridinyl)-3-methylpentanoic acid.
| Compound Name | (2R,3S)-2-(3,5-dinitro-4-oxo-1-pyridinyl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 125114914 |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2R,3S)-2-(3,5-dinitro-4-oxo-1-pyridinyl)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](C(=O)O)n1cc([N+](=O)[O-])c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O7/c1-3-6(2)9(11(16)17)12-4-7(13(18)19)10(15)8(5-12)14(20)21/h4-6,9H,3H2,1-2H3,(H,16,17)/t6-,9+/m0/s1 |
| InChIKey | WZCCJMKRDRVLJD-IMTBSYHQSA-N |
| XLogP | 1.34 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|