C8H9N3O5 — CID 125114982
1,2,6-trimethyl-3,5-dinitropyridin-4-one (PubChem CID 125114982) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 1,2,6-trimethyl-3,5-dinitropyridin-4-one.
| Compound Name | 1,2,6-trimethyl-3,5-dinitropyridin-4-one |
|---|---|
| PubChem CID | 125114982 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 1,2,6-trimethyl-3,5-dinitropyridin-4-one |
| SMILES | Cc1c([N+](=O)[O-])c(=O)c([N+](=O)[O-])c(C)n1C |
| InChI | InChI=1S/C8H9N3O5/c1-4-6(10(13)14)8(12)7(11(15)16)5(2)9(4)3/h1-3H3 |
| InChIKey | YQIWBBCJIBWESX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|