C18H25N3O — CID 125115294
[1-[(3S)-1,2,3,4,5,6,7,8-octahydrophenanthren-3-yl]propylideneamino]urea (PubChem CID 125115294) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is [1-[(3S)-1,2,3,4,5,6,7,8-octahydrophenanthren-3-yl]propylideneamino]urea.
| Compound Name | [1-[(3S)-1,2,3,4,5,6,7,8-octahydrophenanthren-3-yl]propylideneamino]urea |
|---|---|
| PubChem CID | 125115294 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | [1-[(3S)-1,2,3,4,5,6,7,8-octahydrophenanthren-3-yl]propylideneamino]urea |
| SMILES | CCC(=NNC(N)=O)[C@H]1CCc2ccc3c(c2C1)CCCC3 |
| InChI | InChI=1S/C18H25N3O/c1-2-17(20-21-18(19)22)14-10-9-13-8-7-12-5-3-4-6-15(12)16(13)11-14/h7-8,14H,2-6,9-11H2,1H3,(H3,19,21,22)/t14-/m0/s1 |
| InChIKey | DPFCBSFBSBYUMO-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|