C38H32N10O2 — CID 125115562
N-[(E)-[(2R,4E)-5-imino-2-[4-[(2S,3Z,4Z)-5-imino-3,4-bis(phenylhydrazinylidene)oxolan-2-yl]phenyl]-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline (PubChem CID 125115562) has the molecular formula C38H32N10O2 and a molecular weight of 660.74 g/mol. Its IUPAC name is N-[(E)-[(2R,4E)-5-imino-2-[4-[(2S,3Z,4Z)-5-imino-3,4-bis(phenylhydrazinylidene)oxolan-2-yl]phenyl]-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(2R,4E)-5-imino-2-[4-[(2S,3Z,4Z)-5-imino-3,4-bis(phenylhydrazinylidene)oxolan-2-yl]phenyl]-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline |
|---|---|
| PubChem CID | 125115562 |
| Molecular Formula | C38H32N10O2 |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | N-[(E)-[(2R,4E)-5-imino-2-[4-[(2S,3Z,4Z)-5-imino-3,4-bis(phenylhydrazinylidene)oxolan-2-yl]phenyl]-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline |
| SMILES | [H]/N=C1\O[C@@H](c2ccc([C@H]3OC(=N\[H])/C(=N/Nc4ccccc4)C\3=N\Nc3ccccc3)cc2)C(=N\Nc2ccccc2)/C1=N/Nc1ccccc1 |
| InChI | InChI=1S/C38H32N10O2/c39-37-33(47-43-29-17-9-3-10-18-29)31(45-41-27-13-5-1-6-14-27)35(49-37)25-21-23-26(24-22-25)36-32(46-42-28-15-7-2-8-16-28)34(38(40)50-36)48-44-30-19-11-4-12-20-30/h1-24,35-36,39-44H/b39-37-,40-38-,45-31-,46-32+,47-33-,48-34+/t35-,36+/m0/s1 |
| InChIKey | HCBZHEUGOSKSSC-UCJHWRACSA-N |
| XLogP | 7.66 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|