C17H24N2O4 — CID 125118078
[(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4,5-trimethoxyphenyl)methanone (PubChem CID 125118078) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4,5-trimethoxyphenyl)methanone.
| Compound Name | [(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 125118078 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)N2CC[C@H]3CNC[C@H]3C2)cc1OC |
| InChI | InChI=1S/C17H24N2O4/c1-21-14-7-16(23-3)15(22-2)6-13(14)17(20)19-5-4-11-8-18-9-12(11)10-19/h6-7,11-12,18H,4-5,8-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | CTLFGQRJDKZHPM-RYUDHWBXSA-N |
| XLogP | 1.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |