C26H38O5S — CID 125121361
5-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-dimethyl-5-oxopentanethioic S-acid (PubChem CID 125121361) has the molecular formula C26H38O5S and a molecular weight of 462.65 g/mol. Its IUPAC name is 5-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-dimethyl-5-oxopentanethioic S-acid.
| Compound Name | 5-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-dimethyl-5-oxopentanethioic S-acid |
|---|---|
| PubChem CID | 125121361 |
| Molecular Formula | C26H38O5S |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 5-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-dimethyl-5-oxopentanethioic S-acid |
| SMILES | CC(C)(CCC(=O)[C@@]1(O)CC[C@@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C)C(=O)S |
| InChI | InChI=1S/C26H38O5S/c1-23(2,22(30)32)10-9-20(29)26(31)12-8-18-17-6-5-15-13-16(27)7-11-24(15,3)21(17)19(28)14-25(18,26)4/h13,17-19,21,28,31H,5-12,14H2,1-4H3,(H,30,32)/t17-,18-,19+,21-,24+,25+,26+/m1/s1 |
| InChIKey | FXNVRNSBIOLLLH-IHZCZCJXSA-N |
| XLogP | 4.05 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|