C27H31NO7 — CID 125122676
(3S)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-N-(3-phenylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 125122676) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (3S)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-N-(3-phenylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | (3S)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-N-(3-phenylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 125122676 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (3S)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-N-(3-phenylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc([C@H](CC(=O)NCCCc2ccccc2)c2c(O)cc(C)oc2=O)c(OC)c1OC |
| InChI | InChI=1S/C27H31NO7/c1-17-15-21(29)24(27(31)35-17)20(19-12-13-22(32-2)26(34-4)25(19)33-3)16-23(30)28-14-8-11-18-9-6-5-7-10-18/h5-7,9-10,12-13,15,20,29H,8,11,14,16H2,1-4H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | NKBCSZXMYLAVHU-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|