C26H21NO6 — CID 125123140
(6R)-6-(7-methoxy-2-oxo-1H-quinolin-3-yl)-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione (PubChem CID 125123140) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is (6R)-6-(7-methoxy-2-oxo-1H-quinolin-3-yl)-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione.
| Compound Name | (6R)-6-(7-methoxy-2-oxo-1H-quinolin-3-yl)-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione |
|---|---|
| PubChem CID | 125123140 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (6R)-6-(7-methoxy-2-oxo-1H-quinolin-3-yl)-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione |
| SMILES | COc1ccc2cc([C@@H]3CC(=O)Oc4c3c(C)cc3oc(=O)c5c(c43)CCC5)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H21NO6/c1-12-8-20-23(15-4-3-5-16(15)26(30)32-20)24-22(12)17(11-21(28)33-24)18-9-13-6-7-14(31-2)10-19(13)27-25(18)29/h6-10,17H,3-5,11H2,1-2H3,(H,27,29)/t17-/m0/s1 |
| InChIKey | VYVATQGTQVDBDU-KRWDZBQOSA-N |
| XLogP | 3.88 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|