C23H26N6O4 — CID 125123626
5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(1-methylpyrazol-4-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 125123626) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(1-methylpyrazol-4-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(1-methylpyrazol-4-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125123626 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(1-methylpyrazol-4-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c([C@H](c2cnn(C)c2)C2C(=O)N(C)C(=O)N(C)C2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N6O4/c1-14-15(2)29(33)20(28(14)12-16-9-7-6-8-10-16)18(17-11-24-25(3)13-17)19-21(30)26(4)23(32)27(5)22(19)31/h6-11,13,18-19H,12H2,1-5H3/t18-/m1/s1 |
| InChIKey | HKOGLFXTEPYQSN-GOSISDBHSA-N |
| XLogP | 1.32 |
| TPSA | 107.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|