C17H24N2OS — CID 125123675
(2R)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide (PubChem CID 125123675) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (2R)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide.
| Compound Name | (2R)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 125123675 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2R)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
| SMILES | CSCC[C@H](C(=O)NC[C@H]1C[C@H]2C=C[C@H]1C2)n1cccc1 |
| InChI | InChI=1S/C17H24N2OS/c1-21-9-6-16(19-7-2-3-8-19)17(20)18-12-15-11-13-4-5-14(15)10-13/h2-5,7-8,13-16H,6,9-12H2,1H3,(H,18,20)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | IVPUKVLRZJEFOW-CAOSSQGBSA-N |
| XLogP | 3.11 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|