C28H28N2O6 — CID 125123685
5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(2H-chromen-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 125123685) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(2H-chromen-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(2H-chromen-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 125123685 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 5-[(S)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(2H-chromen-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1c(C)[n+]([O-])c([C@H](C2=Cc3ccccc3OC2)C2C(=O)OC(C)(C)OC2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C28H28N2O6/c1-17-18(2)30(33)25(29(17)15-19-10-6-5-7-11-19)23(24-26(31)35-28(3,4)36-27(24)32)21-14-20-12-8-9-13-22(20)34-16-21/h5-14,23-24H,15-16H2,1-4H3/t23-/m1/s1 |
| InChIKey | IYXANCNELVRMFF-HSZRJFAPSA-N |
| XLogP | 3.80 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|