C26H15FN2O4 — CID 125123899
(10S)-3-(2-fluorophenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 125123899) has the molecular formula C26H15FN2O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is (10S)-3-(2-fluorophenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10S)-3-(2-fluorophenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 125123899 |
| Molecular Formula | C26H15FN2O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (10S)-3-(2-fluorophenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2ccc3nccnc3c2)c2c(ccc3c(=O)c(-c4ccccc4F)coc23)O1 |
| InChI | InChI=1S/C26H15FN2O4/c27-19-4-2-1-3-15(19)18-13-32-26-16(25(18)31)6-8-22-24(26)17(12-23(30)33-22)14-5-7-20-21(11-14)29-10-9-28-20/h1-11,13,17H,12H2/t17-/m0/s1 |
| InChIKey | PBLGLUPCAIVVOC-KRWDZBQOSA-N |
| XLogP | 4.98 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|