C25H23F3N4O4 — CID 125124136
5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3,4,5-trifluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 125124136) has the molecular formula C25H23F3N4O4 and a molecular weight of 500.48 g/mol. Its IUPAC name is 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3,4,5-trifluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3,4,5-trifluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125124136 |
| Molecular Formula | C25H23F3N4O4 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3,4,5-trifluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c([C@@H](c2cc(F)c(F)c(F)c2)C2C(=O)N(C)C(=O)N(C)C2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23F3N4O4/c1-13-14(2)32(36)22(31(13)12-15-8-6-5-7-9-15)19(16-10-17(26)21(28)18(27)11-16)20-23(33)29(3)25(35)30(4)24(20)34/h5-11,19-20H,12H2,1-4H3/t19-/m0/s1 |
| InChIKey | WDCZNPONXGWTTL-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 89.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|