C25H26N4O5 — CID 125124282
5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 125124282) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125124282 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c([C@@H](c2ccc(O)cc2)C2C(=O)N(C)C(=O)N(C)C2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H26N4O5/c1-15-16(2)29(34)22(28(15)14-17-8-6-5-7-9-17)20(18-10-12-19(30)13-11-18)21-23(31)26(3)25(33)27(4)24(21)32/h5-13,20-21,30H,14H2,1-4H3/t20-/m0/s1 |
| InChIKey | ZJKKJHHJPKBLCP-FQEVSTJZSA-N |
| XLogP | 2.29 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|