C22H28O5 — CID 125124712
(3S,10S,13R,14S)-3,6-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,12,15,16-hexahydrocyclopenta[a]phenanthrene-7,11,17-trione (PubChem CID 125124712) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3S,10S,13R,14S)-3,6-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,12,15,16-hexahydrocyclopenta[a]phenanthrene-7,11,17-trione.
| Compound Name | (3S,10S,13R,14S)-3,6-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,12,15,16-hexahydrocyclopenta[a]phenanthrene-7,11,17-trione |
|---|---|
| PubChem CID | 125124712 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3S,10S,13R,14S)-3,6-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,12,15,16-hexahydrocyclopenta[a]phenanthrene-7,11,17-trione |
| SMILES | CC1(C)C2=C(O)C(=O)C3=C(C(=O)C[C@@]4(C)C(=O)CC[C@]34C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C22H28O5/c1-19(2)12(24)6-8-20(3)14-11(23)10-22(5)13(25)7-9-21(22,4)15(14)16(26)17(27)18(19)20/h12,24,27H,6-10H2,1-5H3/t12-,20+,21+,22-/m0/s1 |
| InChIKey | GVIAMIGKWDQCSW-TYVQGBEVSA-N |
| XLogP | 3.21 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |