C22H19FN4O4 — CID 125126164
(6S)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (PubChem CID 125126164) has the molecular formula C22H19FN4O4 and a molecular weight of 422.42 g/mol. Its IUPAC name is (6S)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine.
| Compound Name | (6S)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 125126164 |
| Molecular Formula | C22H19FN4O4 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (6S)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| SMILES | COc1ccc(-c2noc(-c3cc4n(n3)C[C@H](c3ccc(F)cc3)OC4)n2)cc1OC |
| InChI | InChI=1S/C22H19FN4O4/c1-28-18-8-5-14(9-19(18)29-2)21-24-22(31-26-21)17-10-16-12-30-20(11-27(16)25-17)13-3-6-15(23)7-4-13/h3-10,20H,11-12H2,1-2H3/t20-/m1/s1 |
| InChIKey | DCTYBAQRPNWEOR-HXUWFJFHSA-N |
| XLogP | 4.03 |
| TPSA | 84.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |