C18H20N6O2 — CID 125126393
(6R)-6-phenyl-N-(3-pyrazol-1-ylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide (PubChem CID 125126393) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (6R)-6-phenyl-N-(3-pyrazol-1-ylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide.
| Compound Name | (6R)-6-phenyl-N-(3-pyrazol-1-ylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide |
|---|---|
| PubChem CID | 125126393 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (6R)-6-phenyl-N-(3-pyrazol-1-ylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1nnn2c1CO[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C18H20N6O2/c25-18(19-8-4-10-23-11-5-9-20-23)17-15-13-26-16(12-24(15)22-21-17)14-6-2-1-3-7-14/h1-3,5-7,9,11,16H,4,8,10,12-13H2,(H,19,25)/t16-/m0/s1 |
| InChIKey | FUUNNBVDNHULCP-INIZCTEOSA-N |
| XLogP | 1.57 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|