C19H20N4OS — CID 125127610
(7R)-7-(3-phenylpropylamino)-2-thiophen-2-yl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 125127610) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (7R)-7-(3-phenylpropylamino)-2-thiophen-2-yl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | (7R)-7-(3-phenylpropylamino)-2-thiophen-2-yl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 125127610 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (7R)-7-(3-phenylpropylamino)-2-thiophen-2-yl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | O=C1NC[C@H](NCCCc2ccccc2)n2nc(-c3cccs3)cc21 |
| InChI | InChI=1S/C19H20N4OS/c24-19-16-12-15(17-9-5-11-25-17)22-23(16)18(13-21-19)20-10-4-8-14-6-2-1-3-7-14/h1-3,5-7,9,11-12,18,20H,4,8,10,13H2,(H,21,24)/t18-/m1/s1 |
| InChIKey | ODUJCGVOXDQWSK-GOSISDBHSA-N |
| XLogP | 3.08 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|