C17H24O3S — CID 12512857
(6E)-2,6-dimethyl-8-(4-methylphenyl)sulfonylocta-1,6-dien-3-ol (PubChem CID 12512857) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-8-(4-methylphenyl)sulfonylocta-1,6-dien-3-ol.
| Compound Name | (6E)-2,6-dimethyl-8-(4-methylphenyl)sulfonylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 12512857 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (6E)-2,6-dimethyl-8-(4-methylphenyl)sulfonylocta-1,6-dien-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O3S/c1-13(2)17(18)10-7-15(4)11-12-21(19,20)16-8-5-14(3)6-9-16/h5-6,8-9,11,17-18H,1,7,10,12H2,2-4H3/b15-11+ |
| InChIKey | JWBJIWSWTGXUSX-RVDMUPIBSA-N |
| XLogP | 3.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|