About 4-chloro-N-propylaniline
4-chloro-N-propylaniline (PubChem CID 12512909) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is 4-chloro-N-propylaniline.
Molecular Properties
| Compound Name | 4-chloro-N-propylaniline |
| PubChem CID | 12512909 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-chloro-N-propylaniline |
| SMILES | CCCNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H12ClN/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6,11H,2,7H2,1H3 |
| InChIKey | PKLDFALGUIOLDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-propylaniline?
The IUPAC name of 4-chloro-N-propylaniline (CID 12512909) is 4-chloro-N-propylaniline.
What is the SMILES notation for 4-chloro-N-propylaniline?
The canonical SMILES for 4-chloro-N-propylaniline is CCCNc1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-propylaniline?
The InChIKey is PKLDFALGUIOLDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6,11H,2,7H2,1H3.
What are the key properties of 4-chloro-N-propylaniline?
4-chloro-N-propylaniline has a molecular weight of 169.66 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-propylaniline is sourced from PubChem (CID 12512909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).