C11H18F7O2P — CID 12512965
1,1,2,2,3,3,3-heptafluoropropyl-bis(2-methylpropoxy)phosphane (PubChem CID 12512965) has the molecular formula C11H18F7O2P and a molecular weight of 346.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl-bis(2-methylpropoxy)phosphane.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl-bis(2-methylpropoxy)phosphane |
|---|---|
| PubChem CID | 12512965 |
| Molecular Formula | C11H18F7O2P |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl-bis(2-methylpropoxy)phosphane |
| SMILES | CC(C)COP(OCC(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H18F7O2P/c1-7(2)5-19-21(20-6-8(3)4)11(17,18)9(12,13)10(14,15)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | LORHZUUJAHAHOO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|