About tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane
tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane (PubChem CID 125130358) has the molecular formula C15H29F3Sn
and a molecular weight of 385.10 g/mol. Its IUPAC name is tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane.
Molecular Properties
| Compound Name | tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane |
| PubChem CID | 125130358 |
| Molecular Formula | C15H29F3Sn |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane |
| SMILES | C=C(C(F)(F)F)[Sn](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/3C4H9.C3H2F3.Sn/c3*1-4(2)3;1-2-3(4,5)6;/h3*1-3H3;1H2; |
| InChIKey | IXBUKPXDWLBVHC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane?
The IUPAC name of tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane (CID 125130358) is tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane.
What is the SMILES notation for tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane?
The canonical SMILES for tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane is C=C(C(F)(F)F)[Sn](C(C)(C)C)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane?
The InChIKey is IXBUKPXDWLBVHC-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H2F3.Sn/c3*1-4(2)3;1-2-3(4,5)6;/h3*1-3H3;1H2;.
What are the key properties of tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane?
tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane has a molecular weight of 385.10 g/mol, XLogP of 6.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tritert-butyl(3,3,3-trifluoroprop-1-en-2-yl)stannane is sourced from PubChem (CID 125130358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).